About benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane
benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane (PubChem CID 158974758) has the molecular formula C44H50P2+2
and a molecular weight of 640.83 g/mol. Its IUPAC name is benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane.
Molecular Properties
| Compound Name | benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane |
| PubChem CID | 158974758 |
| Molecular Formula | C44H50P2+2 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.34 |
| IUPAC Name | benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane |
| SMILES | C.C.c1ccc(C[P+](CCCC[P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H42P2.2CH4/c1-7-21-37(22-8-1)35-43(39-25-11-3-12-26-39,40-27-13-4-14-28-40)33-19-20-34-44(41-29-15-5-16-30-41,42-31-17-6-18-32-42)36-38-23-9-2-10-24-38;;/h1-18,21-32H,19-20,33-36H2;2*1H4/q+2;; |
| InChIKey | JOGFZRVNEAXGQU-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane?
The IUPAC name of benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane (CID 158974758) is benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane.
What is the SMILES notation for benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane?
The canonical SMILES for benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane is C.C.c1ccc(C[P+](CCCC[P+](Cc2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane?
The InChIKey is JOGFZRVNEAXGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H42P2.2CH4/c1-7-21-37(22-8-1)35-43(39-25-11-3-12-26-39,40-27-13-4-14-28-40)33-19-20-34-44(41-29-15-5-16-30-41,42-31-17-6-18-32-42)36-38-23-9-2-10-24-38;;/h1-18,21-32H,19-20,33-36H2;2*1H4/q+2;;.
What are the key properties of benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane?
benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane has a molecular weight of 640.83 g/mol, XLogP of 10.78, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[4-[benzyl(diphenyl)phosphaniumyl]butyl]-diphenylphosphanium;methane is sourced from PubChem (CID 158974758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).