C21H35NO6 — CID 158975658
dipropyl pyridine-2,5-dicarboxylate;2-ethylhexane-1,3-diol (PubChem CID 158975658) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is dipropyl pyridine-2,5-dicarboxylate;2-ethylhexane-1,3-diol.
| Compound Name | dipropyl pyridine-2,5-dicarboxylate;2-ethylhexane-1,3-diol |
|---|---|
| PubChem CID | 158975658 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | dipropyl pyridine-2,5-dicarboxylate;2-ethylhexane-1,3-diol |
| SMILES | CCCC(O)C(CC)CO.CCCOC(=O)c1ccc(C(=O)OCCC)nc1 |
| InChI | InChI=1S/C13H17NO4.C8H18O2/c1-3-7-17-12(15)10-5-6-11(14-9-10)13(16)18-8-4-2;1-3-5-8(10)7(4-2)6-9/h5-6,9H,3-4,7-8H2,1-2H3;7-10H,3-6H2,1-2H3 |
| InChIKey | JOJAMXYGZZZQGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |