C27H42N2 — CID 158976390
4-N',3-dimethyl-5,10-diphenyl-5-propan-2-yldecane-4,4-diamine (PubChem CID 158976390) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is 4-N',3-dimethyl-5,10-diphenyl-5-propan-2-yldecane-4,4-diamine.
| Compound Name | 4-N',3-dimethyl-5,10-diphenyl-5-propan-2-yldecane-4,4-diamine |
|---|---|
| PubChem CID | 158976390 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | 4-N',3-dimethyl-5,10-diphenyl-5-propan-2-yldecane-4,4-diamine |
| SMILES | CCC(C)C(N)(NC)C(CCCCCc1ccccc1)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H42N2/c1-6-23(4)27(28,29-5)26(22(2)3,25-19-13-8-14-20-25)21-15-9-12-18-24-16-10-7-11-17-24/h7-8,10-11,13-14,16-17,19-20,22-23,29H,6,9,12,15,18,21,28H2,1-5H3 |
| InChIKey | JOLILTKLNFZBJO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|