C27H44Cl2N2 — CID 88712281
1-N-methyl-1-N'-(2-methylpropyl)-2,7-diphenyl-2-propan-2-ylheptane-1,1-diamine;dihydrochloride (PubChem CID 88712281) has the molecular formula C27H44Cl2N2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-N-methyl-1-N'-(2-methylpropyl)-2,7-diphenyl-2-propan-2-ylheptane-1,1-diamine;dihydrochloride.
| Compound Name | 1-N-methyl-1-N'-(2-methylpropyl)-2,7-diphenyl-2-propan-2-ylheptane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 88712281 |
| Molecular Formula | C27H44Cl2N2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 1-N-methyl-1-N'-(2-methylpropyl)-2,7-diphenyl-2-propan-2-ylheptane-1,1-diamine;dihydrochloride |
| SMILES | CNC(NCC(C)C)C(CCCCCc1ccccc1)(c1ccccc1)C(C)C.Cl.Cl |
| InChI | InChI=1S/C27H42N2.2ClH/c1-22(2)21-29-26(28-5)27(23(3)4,25-18-12-7-13-19-25)20-14-8-11-17-24-15-9-6-10-16-24;;/h6-7,9-10,12-13,15-16,18-19,22-23,26,28-29H,8,11,14,17,20-21H2,1-5H3;2*1H |
| InChIKey | SGRWTTKOLXOKLA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|