C17H29BF3NO4 — CID 158984722
carbamic acid;(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 158984722) has the molecular formula C17H29BF3NO4 and a molecular weight of 379.23 g/mol. Its IUPAC name is carbamic acid;(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | carbamic acid;(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 158984722 |
| Molecular Formula | C17H29BF3NO4 |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | carbamic acid;(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2R)-1,1,1-trifluoro-4-methylpentan-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC(C)C[C@@H](B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)C(F)(F)F.NC(=O)O |
| InChI | InChI=1S/C16H26BF3O2.CH3NO2/c1-9(2)6-12(16(18,19)20)17-21-13-8-10-7-11(14(10,3)4)15(13,5)22-17;2-1(3)4/h9-13H,6-8H2,1-5H3;2H2,(H,3,4)/t10-,11-,12+,13+,15-;/m0./s1 |
| InChIKey | JPKWWHHTNJFBPS-AJQRTZQTSA-N |
| XLogP | 4.32 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|