C17H29BF3NO4 — CID 162053788
(1R)-3-methyl-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 162053788) has the molecular formula C17H29BF3NO4 and a molecular weight of 379.23 g/mol. Its IUPAC name is (1R)-3-methyl-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (1R)-3-methyl-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162053788 |
| Molecular Formula | C17H29BF3NO4 |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (1R)-3-methyl-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C[C@H](N)B1OC2CC3CC(C3(C)C)[C@@]2(C)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H28BNO2.C2HF3O2/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16;3-2(4,5)1(6)7/h9-13H,6-8,17H2,1-5H3;(H,6,7)/t10?,11?,12?,13-,15+;/m0./s1 |
| InChIKey | SRFQKJZNJYTMNI-VKYFRFQRSA-N |
| XLogP | 3.26 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|