C42H64BrN7O14 — CID 158985010
2-[[5-[(4-bromophenyl)methyl-[7-oxo-8-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]octanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid (PubChem CID 158985010) has the molecular formula C42H64BrN7O14 and a molecular weight of 970.91 g/mol. Its IUPAC name is 2-[[5-[(4-bromophenyl)methyl-[7-oxo-8-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]octanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid.
| Compound Name | 2-[[5-[(4-bromophenyl)methyl-[7-oxo-8-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]octanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 158985010 |
| Molecular Formula | C42H64BrN7O14 |
| Molecular Weight | 970.91 g/mol |
| Exact Mass | 969.37 |
| IUPAC Name | 2-[[5-[(4-bromophenyl)methyl-[7-oxo-8-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]octanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid |
| SMILES | CC(=O)CCC(NC(=O)NC(CCCCN(Cc1ccc(Br)cc1)C(=O)CCCCCC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C42H64BrN7O14/c1-30(51)10-15-35(41(62)63)45-42(64)44-34(40(60)61)8-5-6-16-50(25-31-11-13-32(43)14-12-31)36(53)9-4-2-3-7-33(52)26-46-17-19-47(27-37(54)55)21-23-49(29-39(58)59)24-22-48(20-18-46)28-38(56)57/h11-14,34-35H,2-10,15-29H2,1H3,(H,54,55)(H,56,57)(H,58,59)(H,60,61)(H,62,63)(H2,44,45,64) |
| InChIKey | GYRHBZUHOUJQPG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 295.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.91 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|