C41H63BrN8O14 — CID 167683886
4-[[5-[(4-bromophenyl)methyl-[5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid (PubChem CID 167683886) has the molecular formula C41H63BrN8O14 and a molecular weight of 971.90 g/mol. Its IUPAC name is 4-[[5-[(4-bromophenyl)methyl-[5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid.
| Compound Name | 4-[[5-[(4-bromophenyl)methyl-[5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 167683886 |
| Molecular Formula | C41H63BrN8O14 |
| Molecular Weight | 971.90 g/mol |
| Exact Mass | 970.36 |
| IUPAC Name | 4-[[5-[(4-bromophenyl)methyl-[5-[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]-5-oxohexanoic acid |
| SMILES | CC(=O)C(CCC(=O)O)NC(=O)NC(CCCCN(Cc1ccc(Br)cc1)C(=O)CCCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C41H63BrN8O14/c1-29(51)32(12-13-36(54)55)44-41(64)45-33(40(62)63)6-3-5-15-50(24-30-8-10-31(42)11-9-30)35(53)7-2-4-14-43-34(52)25-46-16-18-47(26-37(56)57)20-22-49(28-39(60)61)23-21-48(19-17-46)27-38(58)59/h8-11,32-33H,2-7,12-28H2,1H3,(H,43,52)(H,54,55)(H,56,57)(H,58,59)(H,60,61)(H,62,63)(H2,44,45,64) |
| InChIKey | FXUVPAZHRLYTFQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 307.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.90 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|