C39H57BrN8O15 — CID 170288335
2-[[5-[(4-bromophenyl)methyl-[5-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododecene-2-carbonyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 170288335) has the molecular formula C39H57BrN8O15 and a molecular weight of 957.83 g/mol. Its IUPAC name is 2-[[5-[(4-bromophenyl)methyl-[5-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododecene-2-carbonyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[5-[(4-bromophenyl)methyl-[5-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododecene-2-carbonyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 170288335 |
| Molecular Formula | C39H57BrN8O15 |
| Molecular Weight | 957.83 g/mol |
| Exact Mass | 956.31 |
| IUPAC Name | 2-[[5-[(4-bromophenyl)methyl-[5-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododecene-2-carbonyl]amino]pentanoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCN(Cc1ccc(Br)cc1)C(=O)CCCCNC(=O)/C1=N\CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)C1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C39H57BrN8O15/c40-27-9-7-26(8-10-27)21-48(15-4-2-5-28(37(59)60)43-39(63)44-29(38(61)62)11-12-32(50)51)31(49)6-1-3-13-42-36(58)30-22-47(25-35(56)57)20-19-46(24-34(54)55)18-17-45(16-14-41-30)23-33(52)53/h7-10,28-29H,1-6,11-25H2,(H,42,58)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,59,60)(H,61,62)(H2,43,44,63)/b41-30- |
| InChIKey | LGCWXIDRHHCWRK-CTYAKMLPSA-N |
| XLogP | -0.08 |
| TPSA | 336.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.83 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|