C57H61N3O2S — CID 158986864
2,4-dimethyl-N-[4-[10-(4-methylphenyl)deca-1,9-diynyl]phenyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide;S-phenyl 11-(4-methylphenyl)undec-10-ynethioate (PubChem CID 158986864) has the molecular formula C57H61N3O2S and a molecular weight of 852.20 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[10-(4-methylphenyl)deca-1,9-diynyl]phenyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide;S-phenyl 11-(4-methylphenyl)undec-10-ynethioate.
| Compound Name | 2,4-dimethyl-N-[4-[10-(4-methylphenyl)deca-1,9-diynyl]phenyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide;S-phenyl 11-(4-methylphenyl)undec-10-ynethioate |
|---|---|
| PubChem CID | 158986864 |
| Molecular Formula | C57H61N3O2S |
| Molecular Weight | 852.20 g/mol |
| Exact Mass | 851.45 |
| IUPAC Name | 2,4-dimethyl-N-[4-[10-(4-methylphenyl)deca-1,9-diynyl]phenyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide;S-phenyl 11-(4-methylphenyl)undec-10-ynethioate |
| SMILES | Cc1ccc(C#CCCCCCCC#Cc2ccc(NC(=O)c3ccn4c(C)cc(C)nc34)cc2)cc1.Cc1ccc(C#CCCCCCCCCC(=O)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N3O.C24H28OS/c1-25-14-16-28(17-15-25)12-10-8-6-4-5-7-9-11-13-29-18-20-30(21-19-29)35-33(37)31-22-23-36-27(3)24-26(2)34-32(31)36;1-21-17-19-22(20-18-21)13-9-6-4-2-3-5-7-12-16-24(25)26-23-14-10-8-11-15-23/h14-24H,4-9H2,1-3H3,(H,35,37);8,10-11,14-15,17-20H,2-7,12,16H2,1H3 |
| InChIKey | JPRFBMZMFMEWCM-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.20 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|