C32H35N3O5 — CID 140934843
(2,5-dioxocyclopentyl) 11-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]undec-10-ynoate (PubChem CID 140934843) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 11-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]undec-10-ynoate.
| Compound Name | (2,5-dioxocyclopentyl) 11-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]undec-10-ynoate |
|---|---|
| PubChem CID | 140934843 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (2,5-dioxocyclopentyl) 11-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]undec-10-ynoate |
| SMILES | Cc1cc(C)n2ccc(C(=O)Nc3ccc(C#CCCCCCCCCC(=O)OC4C(=O)CCC4=O)cc3)c2n1 |
| InChI | InChI=1S/C32H35N3O5/c1-22-21-23(2)35-20-19-26(31(35)33-22)32(39)34-25-15-13-24(14-16-25)11-9-7-5-3-4-6-8-10-12-29(38)40-30-27(36)17-18-28(30)37/h13-16,19-21,30H,3-8,10,12,17-18H2,1-2H3,(H,34,39) |
| InChIKey | KVLACNCPJQDABQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|