C25H23N3O3 — CID 161107114
(4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate (PubChem CID 161107114) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate.
| Compound Name | (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 161107114 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
| SMILES | Cc1ccc(OC(=O)Cc2cccc(NC(=O)c3ccn4c(C)cc(C)nc34)c2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-16-7-9-21(10-8-16)31-23(29)15-19-5-4-6-20(14-19)27-25(30)22-11-12-28-18(3)13-17(2)26-24(22)28/h4-14H,15H2,1-3H3,(H,27,30) |
| InChIKey | UUPNBBOJTOVRRR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|