About (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate
(4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate (PubChem CID 161107114) has the molecular formula C25H23N3O3
and a molecular weight of 413.48 g/mol. Its IUPAC name is (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate.
Molecular Properties
| Compound Name | (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
| PubChem CID | 161107114 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
| SMILES | Cc1ccc(OC(=O)Cc2cccc(NC(=O)c3ccn4c(C)cc(C)nc34)c2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-16-7-9-21(10-8-16)31-23(29)15-19-5-4-6-20(14-19)27-25(30)22-11-12-28-18(3)13-17(2)26-24(22)28/h4-14H,15H2,1-3H3,(H,27,30) |
| InChIKey | UUPNBBOJTOVRRR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate?
The IUPAC name of (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate (CID 161107114) is (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate.
What is the SMILES notation for (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate?
The canonical SMILES for (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate is Cc1ccc(OC(=O)Cc2cccc(NC(=O)c3ccn4c(C)cc(C)nc34)c2)cc1.
What is the InChIKey of (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate?
The InChIKey is UUPNBBOJTOVRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O3/c1-16-7-9-21(10-8-16)31-23(29)15-19-5-4-6-20(14-19)27-25(30)22-11-12-28-18(3)13-17(2)26-24(22)28/h4-14H,15H2,1-3H3,(H,27,30).
What are the key properties of (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate?
(4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate has a molecular weight of 413.48 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 2-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate is sourced from PubChem (CID 161107114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).