C32H36N4O6 — CID 134242287
(2,5-dioxopyrrolidin-1-yl) 4-[5-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]-2-methylpent-4-yn-2-yl]oxy-2,2-dimethylbutanoate (PubChem CID 134242287) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[5-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]-2-methylpent-4-yn-2-yl]oxy-2,2-dimethylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]-2-methylpent-4-yn-2-yl]oxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 134242287 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-[3-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]-2-methylpent-4-yn-2-yl]oxy-2,2-dimethylbutanoate |
| SMILES | Cc1cc(C)n2ccc(C(=O)Nc3cccc(C#CCC(C)(C)OCCC(C)(C)C(=O)ON4C(=O)CCC4=O)c3)c2n1 |
| InChI | InChI=1S/C32H36N4O6/c1-21-19-22(2)35-17-14-25(28(35)33-21)29(39)34-24-11-7-9-23(20-24)10-8-15-32(5,6)41-18-16-31(3,4)30(40)42-36-26(37)12-13-27(36)38/h7,9,11,14,17,19-20H,12-13,15-16,18H2,1-6H3,(H,34,39) |
| InChIKey | POFFEOCQKIEPGR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|