C20H29N3O2 — CID 121330063
2,4-dimethyl-N-[(1R,3S)-3-pentoxycyclopentyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide (PubChem CID 121330063) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1R,3S)-3-pentoxycyclopentyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide.
| Compound Name | 2,4-dimethyl-N-[(1R,3S)-3-pentoxycyclopentyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 121330063 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2,4-dimethyl-N-[(1R,3S)-3-pentoxycyclopentyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
| SMILES | CCCCCO[C@H]1CC[C@@H](NC(=O)c2ccn3c(C)cc(C)nc23)C1 |
| InChI | InChI=1S/C20H29N3O2/c1-4-5-6-11-25-17-8-7-16(13-17)22-20(24)18-9-10-23-15(3)12-14(2)21-19(18)23/h9-10,12,16-17H,4-8,11,13H2,1-3H3,(H,22,24)/t16-,17+/m1/s1 |
| InChIKey | NUBXDVFRMIWTIE-SJORKVTESA-N |
| XLogP | 3.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|