C22H33N3O2 — CID 146409098
2,4-dimethyl-N-[(1S,4R)-4-pentoxycycloheptyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide (PubChem CID 146409098) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(1S,4R)-4-pentoxycycloheptyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide.
| Compound Name | 2,4-dimethyl-N-[(1S,4R)-4-pentoxycycloheptyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 146409098 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2,4-dimethyl-N-[(1S,4R)-4-pentoxycycloheptyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
| SMILES | CCCCCO[C@@H]1CCC[C@H](NC(=O)c2ccn3c(C)cc(C)nc23)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-4-5-6-14-27-19-9-7-8-18(10-11-19)24-22(26)20-12-13-25-17(3)15-16(2)23-21(20)25/h12-13,15,18-19H,4-11,14H2,1-3H3,(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | KXQFRQLQXBOCRJ-RBUKOAKNSA-N |
| XLogP | 4.59 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|