C21H29F2N3O3 — CID 121330039
N-(4-butoxycyclohexyl)-4-(difluoromethyl)-2-(methoxymethyl)pyrrolo[1,2-a]pyrimidine-8-carboxamide (PubChem CID 121330039) has the molecular formula C21H29F2N3O3 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-(4-butoxycyclohexyl)-4-(difluoromethyl)-2-(methoxymethyl)pyrrolo[1,2-a]pyrimidine-8-carboxamide.
| Compound Name | N-(4-butoxycyclohexyl)-4-(difluoromethyl)-2-(methoxymethyl)pyrrolo[1,2-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 121330039 |
| Molecular Formula | C21H29F2N3O3 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-(4-butoxycyclohexyl)-4-(difluoromethyl)-2-(methoxymethyl)pyrrolo[1,2-a]pyrimidine-8-carboxamide |
| SMILES | CCCCOC1CCC(NC(=O)c2ccn3c(C(F)F)cc(COC)nc23)CC1 |
| InChI | InChI=1S/C21H29F2N3O3/c1-3-4-11-29-16-7-5-14(6-8-16)25-21(27)17-9-10-26-18(19(22)23)12-15(13-28-2)24-20(17)26/h9-10,12,14,16,19H,3-8,11,13H2,1-2H3,(H,25,27) |
| InChIKey | VDHUQHCZBUYYLA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|