C21H32N4O2 — CID 145078548
N-[(1S,3S,4S)-4-butoxy-3-ethylcyclohexyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide (PubChem CID 145078548) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[(1S,3S,4S)-4-butoxy-3-ethylcyclohexyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide.
| Compound Name | N-[(1S,3S,4S)-4-butoxy-3-ethylcyclohexyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 145078548 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[(1S,3S,4S)-4-butoxy-3-ethylcyclohexyl]-2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxamide |
| SMILES | CCCCO[C@H]1CC[C@H](NC(=O)c2ncn3c(C)cc(C)nc23)C[C@@H]1CC |
| InChI | InChI=1S/C21H32N4O2/c1-5-7-10-27-18-9-8-17(12-16(18)6-2)24-21(26)19-20-23-14(3)11-15(4)25(20)13-22-19/h11,13,16-18H,5-10,12H2,1-4H3,(H,24,26)/t16-,17-,18-/m0/s1 |
| InChIKey | INMWTWKPQKFFKP-BZSNNMDCSA-N |
| XLogP | 3.84 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|