C42H74FeN6O12 — CID 158988312
tert-butyl 4-[6-[5-[[4-[5-[[10-[acetyl(hydroxy)amino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-3,6-dioxohexyl]piperidine-1-carboxylate;iron (PubChem CID 158988312) has the molecular formula C42H74FeN6O12 and a molecular weight of 910.93 g/mol. Its IUPAC name is tert-butyl 4-[6-[5-[[4-[5-[[10-[acetyl(hydroxy)amino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-3,6-dioxohexyl]piperidine-1-carboxylate;iron.
| Compound Name | tert-butyl 4-[6-[5-[[4-[5-[[10-[acetyl(hydroxy)amino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-3,6-dioxohexyl]piperidine-1-carboxylate;iron |
|---|---|
| PubChem CID | 158988312 |
| Molecular Formula | C42H74FeN6O12 |
| Molecular Weight | 910.93 g/mol |
| Exact Mass | 910.47 |
| IUPAC Name | tert-butyl 4-[6-[5-[[4-[5-[[10-[acetyl(hydroxy)amino]-4-oxodecanoyl]-hydroxyamino]pentylamino]-4-oxobutanoyl]-hydroxyamino]pentylamino]-3,6-dioxohexyl]piperidine-1-carboxylate;iron |
| SMILES | CC(=O)N(O)CCCCCCC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)CCC1CCN(C(=O)OC(C)(C)C)CC1.[Fe] |
| InChI | InChI=1S/C42H74N6O12.Fe/c1-33(49)46(57)28-12-6-5-9-15-35(50)19-22-39(54)47(58)29-13-8-11-27-44-38(53)21-23-40(55)48(59)30-14-7-10-26-43-37(52)20-18-36(51)17-16-34-24-31-45(32-25-34)41(56)60-42(2,3)4;/h34,57-59H,5-32H2,1-4H3,(H,43,52)(H,44,53); |
| InChIKey | GBSOUIFMSBSWPF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 243.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|