C19H14F3N3O — CID 158989468
3-[[6-cyano-5-(trifluoromethyl)-3H-indol-2-yl]methyl]-N-methylbenzamide (PubChem CID 158989468) has the molecular formula C19H14F3N3O and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-[[6-cyano-5-(trifluoromethyl)-3H-indol-2-yl]methyl]-N-methylbenzamide.
| Compound Name | 3-[[6-cyano-5-(trifluoromethyl)-3H-indol-2-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158989468 |
| Molecular Formula | C19H14F3N3O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-[[6-cyano-5-(trifluoromethyl)-3H-indol-2-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CC2=Nc3cc(C#N)c(C(F)(F)F)cc3C2)c1 |
| InChI | InChI=1S/C19H14F3N3O/c1-24-18(26)12-4-2-3-11(5-12)6-15-7-13-8-16(19(20,21)22)14(10-23)9-17(13)25-15/h2-5,8-9H,6-7H2,1H3,(H,24,26) |
| InChIKey | MKBRENVYIGEUJK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |