C16H14BF3N4O2 — CID 158989582
[3-(2-methyltetrazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]phenyl]boronic acid (PubChem CID 158989582) has the molecular formula C16H14BF3N4O2 and a molecular weight of 362.12 g/mol. Its IUPAC name is [3-(2-methyltetrazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]phenyl]boronic acid.
| Compound Name | [3-(2-methyltetrazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 158989582 |
| Molecular Formula | C16H14BF3N4O2 |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [3-(2-methyltetrazol-5-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]phenyl]boronic acid |
| SMILES | Cn1nnc(-c2cc(B(O)O)ccc2Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H14BF3N4O2/c1-24-22-15(21-23-24)14-9-13(17(25)26)6-5-11(14)7-10-3-2-4-12(8-10)16(18,19)20/h2-6,8-9,25-26H,7H2,1H3 |
| InChIKey | RMWVHBMQIFADBK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|