C16H12BrF3N4 — CID 167681317
5-[5-bromo-2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methyltetrazole (PubChem CID 167681317) has the molecular formula C16H12BrF3N4 and a molecular weight of 397.20 g/mol. Its IUPAC name is 5-[5-bromo-2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methyltetrazole.
| Compound Name | 5-[5-bromo-2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 167681317 |
| Molecular Formula | C16H12BrF3N4 |
| Molecular Weight | 397.20 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 5-[5-bromo-2-[[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methyltetrazole |
| SMILES | Cn1nnc(-c2cc(Br)ccc2Cc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H12BrF3N4/c1-24-22-15(21-23-24)14-9-13(17)7-4-11(14)8-10-2-5-12(6-3-10)16(18,19)20/h2-7,9H,8H2,1H3 |
| InChIKey | BKLJOLXXGFDZEJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |