C18H24N4O4S — CID 158991391
N-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-5-nitro-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 158991391) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-5-nitro-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-5-nitro-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 158991391 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-5-nitro-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CC[C@@H]1C[C@H](CS(=O)(=O)C2CC2)C[C@@H]1Nc1c([N+](=O)[O-])cnc2[nH]ccc12 |
| InChI | InChI=1S/C18H24N4O4S/c1-2-12-7-11(10-27(25,26)13-3-4-13)8-15(12)21-17-14-5-6-19-18(14)20-9-16(17)22(23)24/h5-6,9,11-13,15H,2-4,7-8,10H2,1H3,(H2,19,20,21)/t11-,12+,15-/m0/s1 |
| InChIKey | QVWCMDJVESBDHV-ZOWXZIJZSA-N |
| XLogP | 3.27 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|