C21H21N7O3S — CID 164791167
N-[(3R,4S)-3-ethyl-4-[(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 164791167) has the molecular formula C21H21N7O3S and a molecular weight of 451.51 g/mol. Its IUPAC name is N-[(3R,4S)-3-ethyl-4-[(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[(3R,4S)-3-ethyl-4-[(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 164791167 |
| Molecular Formula | C21H21N7O3S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[(3R,4S)-3-ethyl-4-[(5-isocyano-1H-pyrrolo[2,3-b]pyridin-4-yl)amino]cyclopentyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | [C-]#[N+]c1cnc2[nH]ccc2c1N[C@H]1CC(NS(=O)(=O)c2cccc3nonc23)C[C@H]1CC |
| InChI | InChI=1S/C21H21N7O3S/c1-3-12-9-13(28-32(29,30)18-6-4-5-15-20(18)27-31-26-15)10-16(12)25-19-14-7-8-23-21(14)24-11-17(19)22-2/h4-8,11-13,16,28H,3,9-10H2,1H3,(H2,23,24,25)/t12-,13?,16+/m1/s1 |
| InChIKey | XVOYHDMLHXPNNN-LRRQEPCHSA-N |
| XLogP | 3.60 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|