C16H23N5O6 — CID 159004136
5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid;5-tert-butyl-1H-pyrazole-3-carboxylic acid (PubChem CID 159004136) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid;5-tert-butyl-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid;5-tert-butyl-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 159004136 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5-tert-butyl-4-nitro-1H-pyrazole-3-carboxylic acid;5-tert-butyl-1H-pyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)c1[nH]nc(C(=O)O)c1[N+](=O)[O-].CC(C)(C)c1cc(C(=O)O)n[nH]1 |
| InChI | InChI=1S/C8H11N3O4.C8H12N2O2/c1-8(2,3)6-5(11(14)15)4(7(12)13)9-10-6;1-8(2,3)6-4-5(7(11)12)9-10-6/h1-3H3,(H,9,10)(H,12,13);4H,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | JRRYRRQGRFFTQY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 175.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|