About bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid
bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid (PubChem CID 159007307) has the molecular formula C7H16Cl2NO7P
and a molecular weight of 328.09 g/mol. Its IUPAC name is bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid.
Molecular Properties
| Compound Name | bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid |
| PubChem CID | 159007307 |
| Molecular Formula | C7H16Cl2NO7P |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid |
| SMILES | O=C(O)NCO.O=P(CO)(OCCCl)OCCCl |
| InChI | InChI=1S/C5H11Cl2O4P.C2H5NO3/c6-1-3-10-12(9,5-8)11-4-2-7;4-1-3-2(5)6/h8H,1-5H2;3-4H,1H2,(H,5,6) |
| InChIKey | JSBUDBLLNDCFSS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid?
The IUPAC name of bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid (CID 159007307) is bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid.
What is the SMILES notation for bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid?
The canonical SMILES for bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid is O=C(O)NCO.O=P(CO)(OCCCl)OCCCl.
What is the InChIKey of bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid?
The InChIKey is JSBUDBLLNDCFSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11Cl2O4P.C2H5NO3/c6-1-3-10-12(9,5-8)11-4-2-7;4-1-3-2(5)6/h8H,1-5H2;3-4H,1H2,(H,5,6).
What are the key properties of bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid?
bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid has a molecular weight of 328.09 g/mol, XLogP of 0.84, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-chloroethoxy)phosphorylmethanol;hydroxymethylcarbamic acid is sourced from PubChem (CID 159007307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).