C10H22Cl3N2O3P — CID 3060572
4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol (PubChem CID 3060572) has the molecular formula C10H22Cl3N2O3P and a molecular weight of 355.63 g/mol. Its IUPAC name is 4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol.
| Compound Name | 4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol |
|---|---|
| PubChem CID | 3060572 |
| Molecular Formula | C10H22Cl3N2O3P |
| Molecular Weight | 355.63 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol |
| SMILES | O=P(NCCCCO)(OCCCl)N(CCCl)CCCl |
| InChI | InChI=1S/C10H22Cl3N2O3P/c11-3-7-15(8-4-12)19(17,18-10-5-13)14-6-1-2-9-16/h16H,1-10H2,(H,14,17) |
| InChIKey | XXBMSTCOPVXLOM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.63 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|