C15H25Cl2N4O7P — CID 10576515
(2S)-2-amino-6-[[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]hexanoic acid (PubChem CID 10576515) has the molecular formula C15H25Cl2N4O7P and a molecular weight of 475.27 g/mol. Its IUPAC name is (2S)-2-amino-6-[[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10576515 |
| Molecular Formula | C15H25Cl2N4O7P |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (2S)-2-amino-6-[[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNP(=O)(OCc1ccc([N+](=O)[O-])o1)N(CCCl)CCCl)C(=O)O |
| InChI | InChI=1S/C15H25Cl2N4O7P/c16-6-9-20(10-7-17)29(26,19-8-2-1-3-13(18)15(22)23)27-11-12-4-5-14(28-12)21(24)25/h4-5,13H,1-3,6-11,18H2,(H,19,26)(H,22,23)/t13-,29?/m0/s1 |
| InChIKey | KIWHVNIJSWCIGA-OOBPLEAZSA-N |
| XLogP | 2.76 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|