C21H28ClN4O8P — CID 11692262
(2S)-2-acetamido-3-[4-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]phenyl]propanoic acid (PubChem CID 11692262) has the molecular formula C21H28ClN4O8P and a molecular weight of 530.90 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[4-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-acetamido-3-[4-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11692262 |
| Molecular Formula | C21H28ClN4O8P |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (2S)-2-acetamido-3-[4-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]phenyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(NP(=O)(OCc2ccc([N+](=O)[O-])o2)N(C)CCCCCl)cc1)C(=O)O |
| InChI | InChI=1S/C21H28ClN4O8P/c1-15(27)23-19(21(28)29)13-16-5-7-17(8-6-16)24-35(32,25(2)12-4-3-11-22)33-14-18-9-10-20(34-18)26(30)31/h5-10,19H,3-4,11-14H2,1-2H3,(H,23,27)(H,24,32)(H,28,29)/t19-,35?/m0/s1 |
| InChIKey | STDZSZPRCDOLNJ-WUTYVCDSSA-N |
| XLogP | 4.01 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|