C20H30Cl4N6O10P2 — CID 58463660
N,N'-bis[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]ethane-1,2-diamine (PubChem CID 58463660) has the molecular formula C20H30Cl4N6O10P2 and a molecular weight of 718.25 g/mol. Its IUPAC name is N,N'-bis[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58463660 |
| Molecular Formula | C20H30Cl4N6O10P2 |
| Molecular Weight | 718.25 g/mol |
| Exact Mass | 716.03 |
| IUPAC Name | N,N'-bis[bis(2-chloroethyl)amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(COP(=O)(NCCNP(=O)(OCc2ccc([N+](=O)[O-])o2)N(CCCl)CCCl)N(CCCl)CCCl)o1 |
| InChI | InChI=1S/C20H30Cl4N6O10P2/c21-5-11-27(12-6-22)41(35,37-15-17-1-3-19(39-17)29(31)32)25-9-10-26-42(36,28(13-7-23)14-8-24)38-16-18-2-4-20(40-18)30(33)34/h1-4H,5-16H2,(H,25,35)(H,26,36) |
| InChIKey | WACLPTTYZNHJIM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 195.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|