C16H28ClN2O7P — CID 157432654
3-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-(propoxymethyl)phosphoryl]amino]propan-1-ol (PubChem CID 157432654) has the molecular formula C16H28ClN2O7P and a molecular weight of 426.83 g/mol. Its IUPAC name is 3-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-(propoxymethyl)phosphoryl]amino]propan-1-ol.
| Compound Name | 3-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-(propoxymethyl)phosphoryl]amino]propan-1-ol |
|---|---|
| PubChem CID | 157432654 |
| Molecular Formula | C16H28ClN2O7P |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-(propoxymethyl)phosphoryl]amino]propan-1-ol |
| SMILES | CCCOCP(=O)(OCc1ccc([N+](=O)[O-])o1)N(CCCO)CCCCCl |
| InChI | InChI=1S/C16H28ClN2O7P/c1-2-12-24-14-27(23,18(10-5-11-20)9-4-3-8-17)25-13-15-6-7-16(26-15)19(21)22/h6-7,20H,2-5,8-14H2,1H3 |
| InChIKey | BEPHTXUXPMLJMQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|