C9H13Br2N2O6P — CID 54309944
N,N-bis(2-bromoethyl)-[(5-nitrofuran-2-yl)methoxy]phosphonamidic acid (PubChem CID 54309944) has the molecular formula C9H13Br2N2O6P and a molecular weight of 435.99 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-[(5-nitrofuran-2-yl)methoxy]phosphonamidic acid.
| Compound Name | N,N-bis(2-bromoethyl)-[(5-nitrofuran-2-yl)methoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 54309944 |
| Molecular Formula | C9H13Br2N2O6P |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | N,N-bis(2-bromoethyl)-[(5-nitrofuran-2-yl)methoxy]phosphonamidic acid |
| SMILES | O=[N+]([O-])c1ccc(COP(=O)(O)N(CCBr)CCBr)o1 |
| InChI | InChI=1S/C9H13Br2N2O6P/c10-3-5-12(6-4-11)20(16,17)18-7-8-1-2-9(19-8)13(14)15/h1-2H,3-7H2,(H,16,17) |
| InChIKey | SKDZESQZLRIGAE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|