C15H27N4O8P — CID 90222664
2-[2-hydroxyethyl-[(2-morpholin-4-ylethylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]ethanol (PubChem CID 90222664) has the molecular formula C15H27N4O8P and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(2-morpholin-4-ylethylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[(2-morpholin-4-ylethylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]ethanol |
|---|---|
| PubChem CID | 90222664 |
| Molecular Formula | C15H27N4O8P |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[2-hydroxyethyl-[(2-morpholin-4-ylethylamino)-[(5-nitrofuran-2-yl)methoxy]phosphoryl]amino]ethanol |
| SMILES | O=[N+]([O-])c1ccc(COP(=O)(NCCN2CCOCC2)N(CCO)CCO)o1 |
| InChI | InChI=1S/C15H27N4O8P/c20-9-5-18(6-10-21)28(24,16-3-4-17-7-11-25-12-8-17)26-13-14-1-2-15(27-14)19(22)23/h1-2,20-21H,3-13H2,(H,16,24) |
| InChIKey | ROUHSJMETCELQJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|