C30H48ClN2O6P — CID 46224313
4-chloro-N-methyl-N-[(5-nitrofuran-2-yl)methoxy-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]butan-1-amine (PubChem CID 46224313) has the molecular formula C30H48ClN2O6P and a molecular weight of 599.15 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-[(5-nitrofuran-2-yl)methoxy-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]butan-1-amine.
| Compound Name | 4-chloro-N-methyl-N-[(5-nitrofuran-2-yl)methoxy-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]butan-1-amine |
|---|---|
| PubChem CID | 46224313 |
| Molecular Formula | C30H48ClN2O6P |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 4-chloro-N-methyl-N-[(5-nitrofuran-2-yl)methoxy-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]butan-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)(OCc1ccc([N+](=O)[O-])o1)N(C)CCCCCl |
| InChI | InChI=1S/C30H48ClN2O6P/c1-25(2)12-9-13-26(3)14-10-15-27(4)16-11-17-28(5)20-23-37-40(36,32(6)22-8-7-21-31)38-24-29-18-19-30(39-29)33(34)35/h12,14,16,18-20H,7-11,13,15,17,21-24H2,1-6H3/b26-14+,27-16+,28-20+ |
| InChIKey | MVSJZIIOJWFGGA-YHVVAEAJSA-N |
| XLogP | 9.93 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|