C34H35ClN3O10P — CID 58798954
3-[4-[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 58798954) has the molecular formula C34H35ClN3O10P and a molecular weight of 712.09 g/mol. Its IUPAC name is 3-[4-[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 58798954 |
| Molecular Formula | C34H35ClN3O10P |
| Molecular Weight | 712.09 g/mol |
| Exact Mass | 711.17 |
| IUPAC Name | 3-[4-[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CN(CCCCCl)P(=O)(OCc1ccc([N+](=O)[O-])o1)Oc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C34H35ClN3O10P/c1-37(19-7-6-18-35)49(44,46-21-25-16-17-32(47-25)38(42)43)48-24-14-12-23(13-15-24)20-31(33(39)40)36-34(41)45-22-30-28-10-4-2-8-26(28)27-9-3-5-11-29(27)30/h2-5,8-17,30-31H,6-7,18-22H2,1H3,(H,36,41)(H,39,40) |
| InChIKey | AFXPGPWTTBKLBT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.09 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|