C30H28N3O10P — CID 78038579
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[methylamino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]propanoic acid (PubChem CID 78038579) has the molecular formula C30H28N3O10P and a molecular weight of 621.54 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[methylamino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[methylamino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 78038579 |
| Molecular Formula | C30H28N3O10P |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[methylamino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]oxyphenyl]propanoic acid |
| SMILES | CNP(=O)(OCc1ccc([N+](=O)[O-])o1)Oc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C30H28N3O10P/c1-31-44(39,41-17-21-14-15-28(42-21)33(37)38)43-20-12-10-19(11-13-20)16-27(29(34)35)32-30(36)40-18-26-24-8-4-2-6-22(24)23-7-3-5-9-25(23)26/h2-15,26-27H,16-18H2,1H3,(H,31,39)(H,32,36)(H,34,35) |
| InChIKey | YPDPOWTXJOCUQN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 179.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|