C32H52ClN2O8P — CID 24863192
5-[[[(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienoxy]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-(4-chlorobutyl)amino]pentanoic acid (PubChem CID 24863192) has the molecular formula C32H52ClN2O8P and a molecular weight of 659.20 g/mol. Its IUPAC name is 5-[[[(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienoxy]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-(4-chlorobutyl)amino]pentanoic acid.
| Compound Name | 5-[[[(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienoxy]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-(4-chlorobutyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 24863192 |
| Molecular Formula | C32H52ClN2O8P |
| Molecular Weight | 659.20 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | 5-[[[(2Z,6E)-3-tert-butyl-7,11-dimethyldodeca-2,6,10-trienoxy]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-(4-chlorobutyl)amino]pentanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/COP(=O)(OCc1ccc([N+](=O)[O-])o1)N(CCCCCl)CCCCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C32H52ClN2O8P/c1-26(2)13-11-14-27(3)15-12-16-28(32(4,5)6)20-24-41-44(40,42-25-29-18-19-30(43-29)35(38)39)34(23-10-8-21-33)22-9-7-17-31(36)37/h13,15,18-20H,7-12,14,16-17,21-25H2,1-6H3,(H,36,37)/b27-15+,28-20- |
| InChIKey | OILJYCZCBOOBCP-QLFDPBGFSA-N |
| XLogP | 9.85 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.20 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|