C34H54ClN2O8P — CID 59504257
5-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]amino]pentanoic acid (PubChem CID 59504257) has the molecular formula C34H54ClN2O8P and a molecular weight of 685.24 g/mol. Its IUPAC name is 5-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]amino]pentanoic acid.
| Compound Name | 5-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59504257 |
| Molecular Formula | C34H54ClN2O8P |
| Molecular Weight | 685.24 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 5-[4-chlorobutyl-[(5-nitrofuran-2-yl)methoxy-[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]amino]pentanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C\COP(=O)(OCc1ccc([N+](=O)[O-])o1)N(CCCCCl)CCCCC(=O)O |
| InChI | InChI=1S/C34H54ClN2O8P/c1-28(2)13-10-14-29(3)15-11-16-30(4)17-12-18-31(5)22-26-43-46(42,44-27-32-20-21-33(45-32)37(40)41)36(25-9-7-23-35)24-8-6-19-34(38)39/h13,15,17,20-22H,6-12,14,16,18-19,23-27H2,1-5H3,(H,38,39)/b29-15+,30-17+,31-22- |
| InChIKey | NVMMENGOCJHNLG-PEGBGJTLSA-N |
| XLogP | 10.55 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.24 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|