C9H14Cl2N3O5P — CID 58463604
1-[amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine (PubChem CID 58463604) has the molecular formula C9H14Cl2N3O5P and a molecular weight of 346.11 g/mol. Its IUPAC name is 1-[amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine.
| Compound Name | 1-[amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
|---|---|
| PubChem CID | 58463604 |
| Molecular Formula | C9H14Cl2N3O5P |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[amino-[(5-nitrofuran-2-yl)methoxy]phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine |
| SMILES | NP(=O)(OCc1ccc([N+](=O)[O-])o1)C(CCl)NCCCl |
| InChI | InChI=1S/C9H14Cl2N3O5P/c10-3-4-13-8(5-11)20(12,17)18-6-7-1-2-9(19-7)14(15)16/h1-2,8,13H,3-6H2,(H2,12,17) |
| InChIKey | HTEPVZVOKMCSID-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|