C9H12N2O5S2 — CID 159008380
1-[(2R,4S,5R)-3-(disulfanyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 159008380) has the molecular formula C9H12N2O5S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-(disulfanyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-3-(disulfanyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159008380 |
| Molecular Formula | C9H12N2O5S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 1-[(2R,4S,5R)-3-(disulfanyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@H](O)C2SS)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O5S2/c12-3-4-6(14)7(18-17)8(16-4)11-2-1-5(13)10-9(11)15/h1-2,4,6-8,12,14,17H,3H2,(H,10,13,15)/t4-,6+,7?,8-/m1/s1 |
| InChIKey | NLXIQPHWVCTDEV-JDNPWWSISA-N |
| XLogP | -1.27 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|