C34H45F3N6O3S2 — CID 159010169
N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperidin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 159010169) has the molecular formula C34H45F3N6O3S2 and a molecular weight of 706.90 g/mol. Its IUPAC name is N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperidin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperidin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159010169 |
| Molecular Formula | C34H45F3N6O3S2 |
| Molecular Weight | 706.90 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperidin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COc1nc(NC2CCN(Cc3ccc4c(cc(C)n4C[C@H](C)N4CCC(S(C)(=O)=O)CC4)c3C)CC2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C34H45F3N6O3S2/c1-21-16-28-23(3)24(6-7-30(28)43(21)19-22(2)42-14-10-27(11-15-42)48(5,44)45)20-41-12-8-25(9-13-41)38-31-29-17-26(18-34(35,36)37)47-32(29)40-33(39-31)46-4/h6-7,16-17,22,25,27H,8-15,18-20H2,1-5H3,(H,38,39,40)/t22-/m0/s1 |
| InChIKey | YLJYZGUHCQASGZ-QFIPXVFZSA-N |
| XLogP | 6.35 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.90 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |