C35H48F3N7O2S2 — CID 159466539
N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-propyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 159466539) has the molecular formula C35H48F3N7O2S2 and a molecular weight of 719.94 g/mol. Its IUPAC name is N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-propyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-propyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159466539 |
| Molecular Formula | C35H48F3N7O2S2 |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | N-[1-[[2,4-dimethyl-1-[(2S)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-propyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCc1nc(NC2CCN(Cc3ccc4c(cc(C)n4C[C@H](C)N4CCN(S(C)(=O)=O)CC4)c3C)CC2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C35H48F3N7O2S2/c1-6-7-32-40-33(30-19-28(20-35(36,37)38)48-34(30)41-32)39-27-10-12-42(13-11-27)22-26-8-9-31-29(25(26)4)18-23(2)45(31)21-24(3)43-14-16-44(17-15-43)49(5,46)47/h8-9,18-19,24,27H,6-7,10-17,20-22H2,1-5H3,(H,39,40,41)/t24-/m0/s1 |
| InChIKey | MCDACPKNPRHRBS-DEOSSOPVSA-N |
| XLogP | 6.36 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |