C34H46F3N7O2S2 — CID 158971748
N-[1-[[2,4-dimethyl-1-[(2R)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-ethyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 158971748) has the molecular formula C34H46F3N7O2S2 and a molecular weight of 705.92 g/mol. Its IUPAC name is N-[1-[[2,4-dimethyl-1-[(2R)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-ethyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[[2,4-dimethyl-1-[(2R)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-ethyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 158971748 |
| Molecular Formula | C34H46F3N7O2S2 |
| Molecular Weight | 705.92 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | N-[1-[[2,4-dimethyl-1-[(2R)-2-(4-methylsulfonylpiperazin-1-yl)propyl]indol-5-yl]methyl]piperidin-4-yl]-2-ethyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1nc(NC2CCN(Cc3ccc4c(cc(C)n4C[C@@H](C)N4CCN(S(C)(=O)=O)CC4)c3C)CC2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C34H46F3N7O2S2/c1-6-31-39-32(29-18-27(19-34(35,36)37)47-33(29)40-31)38-26-9-11-41(12-10-26)21-25-7-8-30-28(24(25)4)17-22(2)44(30)20-23(3)42-13-15-43(16-14-42)48(5,45)46/h7-8,17-18,23,26H,6,9-16,19-21H2,1-5H3,(H,38,39,40)/t23-/m1/s1 |
| InChIKey | PXKVJUPVNQSYAQ-HSZRJFAPSA-N |
| XLogP | 5.97 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.92 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |