amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate

C11H22N2O4 — CID 159014627

IUPACamino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate
SMILESCCC(C)(CC(C)(CC)C(=O)ON)OC(N)=O
InChIInChI=1S/C11H22N2O4/c1-5-10(3,8(14)17-13)7-11(4,6-2)16-9(12)15/h5-7,13H2,1-4H3,(H2,12,15)
InChIKeyJSXWZJOMCWHVIU-UHFFFAOYSA-N
MW246.31 g/mol
LogP1.47
Rot. Bonds6

About amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate

amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate (PubChem CID 159014627) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate.

Molecular Properties

Compound Nameamino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate
PubChem CID159014627
Molecular FormulaC11H22N2O4
Molecular Weight246.31 g/mol
Exact Mass246.16
IUPAC Nameamino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate
SMILESCCC(C)(CC(C)(CC)C(=O)ON)OC(N)=O
InChIInChI=1S/C11H22N2O4/c1-5-10(3,8(14)17-13)7-11(4,6-2)16-9(12)15/h5-7,13H2,1-4H3,(H2,12,15)
InChIKeyJSXWZJOMCWHVIU-UHFFFAOYSA-N
XLogP1.47
TPSA104.64 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 51.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate?
The IUPAC name of amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate (CID 159014627) is amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate.
What is the SMILES notation for amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate?
The canonical SMILES for amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate is CCC(C)(CC(C)(CC)C(=O)ON)OC(N)=O.
What is the InChIKey of amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate?
The InChIKey is JSXWZJOMCWHVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c1-5-10(3,8(14)17-13)7-11(4,6-2)16-9(12)15/h5-7,13H2,1-4H3,(H2,12,15).
What are the key properties of amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate?
amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate has a molecular weight of 246.31 g/mol, XLogP of 1.47, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate is sourced from PubChem (CID 159014627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).