C11H22N2O4 — CID 159014627
amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate (PubChem CID 159014627) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate.
| Compound Name | amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate |
|---|---|
| PubChem CID | 159014627 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | amino 4-carbamoyloxy-2-ethyl-2,4-dimethylhexanoate |
| SMILES | CCC(C)(CC(C)(CC)C(=O)ON)OC(N)=O |
| InChI | InChI=1S/C11H22N2O4/c1-5-10(3,8(14)17-13)7-11(4,6-2)16-9(12)15/h5-7,13H2,1-4H3,(H2,12,15) |
| InChIKey | JSXWZJOMCWHVIU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|