C11H23NO6P+ — CID 122691983
2-(3-carbamoyloxy-3-methylpentoxy)butan-2-yloxy-hydroxy-oxophosphanium (PubChem CID 122691983) has the molecular formula C11H23NO6P+ and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-(3-carbamoyloxy-3-methylpentoxy)butan-2-yloxy-hydroxy-oxophosphanium.
| Compound Name | 2-(3-carbamoyloxy-3-methylpentoxy)butan-2-yloxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 122691983 |
| Molecular Formula | C11H23NO6P+ |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(3-carbamoyloxy-3-methylpentoxy)butan-2-yloxy-hydroxy-oxophosphanium |
| SMILES | CCC(C)(CCOC(C)(CC)O[P+](=O)O)OC(N)=O |
| InChI | InChI=1S/C11H22NO6P/c1-5-10(3,17-9(12)13)7-8-16-11(4,6-2)18-19(14)15/h5-8H2,1-4H3,(H2-,12,13,14,15)/p+1 |
| InChIKey | YVGJDSPXIQAAPO-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|