C9H19NO6P+ — CID 90261772
2-(3-carbamoyloxy-3-methylbutoxy)propan-2-yloxy-hydroxy-oxophosphanium (PubChem CID 90261772) has the molecular formula C9H19NO6P+ and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-(3-carbamoyloxy-3-methylbutoxy)propan-2-yloxy-hydroxy-oxophosphanium.
| Compound Name | 2-(3-carbamoyloxy-3-methylbutoxy)propan-2-yloxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90261772 |
| Molecular Formula | C9H19NO6P+ |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-(3-carbamoyloxy-3-methylbutoxy)propan-2-yloxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(CCOC(C)(C)O[P+](=O)O)OC(N)=O |
| InChI | InChI=1S/C9H18NO6P/c1-8(2,15-7(10)11)5-6-14-9(3,4)16-17(12)13/h5-6H2,1-4H3,(H2-,10,11,12,13)/p+1 |
| InChIKey | WGXHHMYJWNVOLY-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|