C14H28IN2O4- — CID 163411995
CID 163411995 (PubChem CID 163411995) has the molecular formula C14H28IN2O4- and a molecular weight of 415.29 g/mol.
| Compound Name | CID 163411995 |
|---|---|
| PubChem CID | 163411995 |
| Molecular Formula | C14H28IN2O4- |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | — |
| SMILES | CCC(C)(CCOC(C)(C)OC(N)=O)OCCCN1C[I-]1 |
| InChI | InChI=1S/C14H28IN2O4/c1-5-14(4,20-9-6-8-17-11-15-17)7-10-19-13(2,3)21-12(16)18/h5-11H2,1-4H3,(H2,16,18)/q-1 |
| InChIKey | OEWZGPQPWLZMFG-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 73.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|