C36H70N2O3 — CID 123492496
4-methyl-4-(3-methyl-3-octadec-9-enoxypentoxy)-1-(4-methylpiperazin-1-yl)hexan-3-one (PubChem CID 123492496) has the molecular formula C36H70N2O3 and a molecular weight of 578.97 g/mol. Its IUPAC name is 4-methyl-4-(3-methyl-3-octadec-9-enoxypentoxy)-1-(4-methylpiperazin-1-yl)hexan-3-one.
| Compound Name | 4-methyl-4-(3-methyl-3-octadec-9-enoxypentoxy)-1-(4-methylpiperazin-1-yl)hexan-3-one |
|---|---|
| PubChem CID | 123492496 |
| Molecular Formula | C36H70N2O3 |
| Molecular Weight | 578.97 g/mol |
| Exact Mass | 578.54 |
| IUPAC Name | 4-methyl-4-(3-methyl-3-octadec-9-enoxypentoxy)-1-(4-methylpiperazin-1-yl)hexan-3-one |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(C)(CC)CCOC(C)(CC)C(=O)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C36H70N2O3/c1-7-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-32-40-35(4,8-2)26-33-41-36(5,9-3)34(39)25-27-38-30-28-37(6)29-31-38/h16-17H,7-15,18-33H2,1-6H3 |
| InChIKey | SCQUUCIFVBQSED-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.97 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|