C47H91N3O4 — CID 67630187
4-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-bis(octadec-9-enoxy)butanamide (PubChem CID 67630187) has the molecular formula C47H91N3O4 and a molecular weight of 762.26 g/mol. Its IUPAC name is 4-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-bis(octadec-9-enoxy)butanamide.
| Compound Name | 4-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-bis(octadec-9-enoxy)butanamide |
|---|---|
| PubChem CID | 67630187 |
| Molecular Formula | C47H91N3O4 |
| Molecular Weight | 762.26 g/mol |
| Exact Mass | 761.70 |
| IUPAC Name | 4-[2-(4-methylpiperazin-1-yl)ethoxy]-2,3-bis(octadec-9-enoxy)butanamide |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(COCCN1CCN(C)CC1)C(OCCCCCCCCC=CCCCCCCCC)C(N)=O |
| InChI | InChI=1S/C47H91N3O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-41-53-45(44-52-43-40-50-38-36-49(3)37-39-50)46(47(48)51)54-42-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,45-46H,4-17,22-44H2,1-3H3,(H2,48,51) |
| InChIKey | ZKUJTGHVXOVLOF-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.26 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|