C47H90N2O4 — CID 172783440
2,4-bis[(Z)-octadec-9-enoxy]-3-(2-piperidin-1-ylethoxy)butanamide (PubChem CID 172783440) has the molecular formula C47H90N2O4 and a molecular weight of 747.25 g/mol. Its IUPAC name is 2,4-bis[(Z)-octadec-9-enoxy]-3-(2-piperidin-1-ylethoxy)butanamide.
| Compound Name | 2,4-bis[(Z)-octadec-9-enoxy]-3-(2-piperidin-1-ylethoxy)butanamide |
|---|---|
| PubChem CID | 172783440 |
| Molecular Formula | C47H90N2O4 |
| Molecular Weight | 747.25 g/mol |
| Exact Mass | 746.69 |
| IUPAC Name | 2,4-bis[(Z)-octadec-9-enoxy]-3-(2-piperidin-1-ylethoxy)butanamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(OCCN1CCCCC1)C(OCCCCCCCC/C=C\CCCCCCCC)C(N)=O |
| InChI | InChI=1S/C47H90N2O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-41-51-44-45(52-43-40-49-38-34-33-35-39-49)46(47(48)50)53-42-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,45-46H,3-16,21-44H2,1-2H3,(H2,48,50)/b19-17-,20-18- |
| InChIKey | OOLVDRSIFCIJTJ-CLFAGFIQSA-N |
| XLogP | 12.82 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.25 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|