C47H91N3O4 — CID 70252901
1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate (PubChem CID 70252901) has the molecular formula C47H91N3O4 and a molecular weight of 762.26 g/mol. Its IUPAC name is 1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate.
| Compound Name | 1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 70252901 |
| Molecular Formula | C47H91N3O4 |
| Molecular Weight | 762.26 g/mol |
| Exact Mass | 761.70 |
| IUPAC Name | 1,3-bis[(Z)-octadec-9-enoxy]propan-2-yl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COCCCCCCCC/C=C\CCCCCCCC)OC(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C47H91N3O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-42-52-44-46(54-47(51)48-36-37-50-40-38-49(3)39-41-50)45-53-43-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,46H,4-17,22-45H2,1-3H3,(H,48,51)/b20-18-,21-19- |
| InChIKey | WAVKAPMIQHIWCR-AUYXYSRISA-N |
| XLogP | 12.44 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.26 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|